Smiles Code
O[C@@H]1C=C[C@@H](O)[C@H](O)[C@H]1O
Standards; Enzyme Activators and Inhibitors; Glycosidase Inhibitors;
Conduritol b acts on b-glucosidases from widely differing sources to show a loss of enzymic activity: from various Aspergillus species, yeast, snail, sweet almonds, and mammals. The other enzymes that have been found to be covalently inhibited are a- glucosidase from yeast and the sucrase-isomaltase complex from rabbit small intestine.